C22H25N3O4S — CID 19357967
N-[4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]acetamide (PubChem CID 19357967) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19357967 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]acetamide |
| SMILES | CCC1SC(=O)N(Cc2ccc(NC(C)=O)cc2)N=C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H25N3O4S/c1-5-20-21(16-8-11-18(28-3)19(12-16)29-4)24-25(22(27)30-20)13-15-6-9-17(10-7-15)23-14(2)26/h6-12,20H,5,13H2,1-4H3,(H,23,26) |
| InChIKey | RWGZZBUQZUXTCC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|