C22H28N2O2 — CID 7288525
2-[N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione (PubChem CID 7288525) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7288525 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[N-[2-(2,5-dimethyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]cyclohexane-1,3-dione |
| SMILES | CCC/C(=N\CCc1c(C)[nH]c2ccc(C)cc12)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C22H28N2O2/c1-4-6-19(22-20(25)7-5-8-21(22)26)23-12-11-16-15(3)24-18-10-9-14(2)13-17(16)18/h9-10,13,22,24H,4-8,11-12H2,1-3H3/b23-19+ |
| InChIKey | UYXWDGWCTNCBGI-FCDQGJHFSA-N |
| XLogP | 4.51 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|