C44H45ClN4O10S2 — CID 157415903
2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;4-but-2-ynoxybenzenesulfonyl chloride;2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methyl-1H-indol-3-yl)propanoic acid (PubChem CID 157415903) has the molecular formula C44H45ClN4O10S2 and a molecular weight of 889.45 g/mol. Its IUPAC name is 2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;4-but-2-ynoxybenzenesulfonyl chloride;2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methyl-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;4-but-2-ynoxybenzenesulfonyl chloride;2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 157415903 |
| Molecular Formula | C44H45ClN4O10S2 |
| Molecular Weight | 889.45 g/mol |
| Exact Mass | 888.23 |
| IUPAC Name | 2-amino-3-(5-methyl-1H-indol-3-yl)propanoic acid;4-but-2-ynoxybenzenesulfonyl chloride;2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methyl-1H-indol-3-yl)propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)Cl)cc1.CC#CCOc1ccc(S(=O)(=O)NC(Cc2c[nH]c3ccc(C)cc23)C(=O)O)cc1.Cc1ccc2[nH]cc(CC(N)C(=O)O)c2c1 |
| InChI | InChI=1S/C22H22N2O5S.C12H14N2O2.C10H9ClO3S/c1-3-4-11-29-17-6-8-18(9-7-17)30(27,28)24-21(22(25)26)13-16-14-23-20-10-5-15(2)12-19(16)20;1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16;1-2-3-8-14-9-4-6-10(7-5-9)15(11,12)13/h5-10,12,14,21,23-24H,11,13H2,1-2H3,(H,25,26);2-4,6,10,14H,5,13H2,1H3,(H,15,16);4-7H,8H2,1H3 |
| InChIKey | BOVNSYUHNPNBMQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 230.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|