C18H16ClFN2O2 — CID 87584825
2-(chloroamino)-3-[1-[(3-fluorophenyl)methyl]indol-3-yl]propanoic acid (PubChem CID 87584825) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is 2-(chloroamino)-3-[1-[(3-fluorophenyl)methyl]indol-3-yl]propanoic acid.
| Compound Name | 2-(chloroamino)-3-[1-[(3-fluorophenyl)methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 87584825 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-(chloroamino)-3-[1-[(3-fluorophenyl)methyl]indol-3-yl]propanoic acid |
| SMILES | O=C(O)C(Cc1cn(Cc2cccc(F)c2)c2ccccc12)NCl |
| InChI | InChI=1S/C18H16ClFN2O2/c19-21-16(18(23)24)9-13-11-22(17-7-2-1-6-15(13)17)10-12-4-3-5-14(20)8-12/h1-8,11,16,21H,9-10H2,(H,23,24) |
| InChIKey | RFFHUKUIVQMYPM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|