C16H11ClF3N3O3 — CID 170561621
methyl 6-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]benzotriazole-4-carboxylate (PubChem CID 170561621) has the molecular formula C16H11ClF3N3O3 and a molecular weight of 385.73 g/mol. Its IUPAC name is methyl 6-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]benzotriazole-4-carboxylate.
| Compound Name | methyl 6-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]benzotriazole-4-carboxylate |
|---|---|
| PubChem CID | 170561621 |
| Molecular Formula | C16H11ClF3N3O3 |
| Molecular Weight | 385.73 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | methyl 6-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]benzotriazole-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)cc2nnn(Cc3ccc(OC(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C16H11ClF3N3O3/c1-25-15(24)12-6-10(17)7-13-14(12)23(22-21-13)8-9-2-4-11(5-3-9)26-16(18,19)20/h2-7H,8H2,1H3 |
| InChIKey | KGWRNUUSUASPQL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |