C25H25F3N2O3 — CID 67335595
methyl 4-[[3-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoate (PubChem CID 67335595) has the molecular formula C25H25F3N2O3 and a molecular weight of 458.48 g/mol. Its IUPAC name is methyl 4-[[3-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 67335595 |
| Molecular Formula | C25H25F3N2O3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | methyl 4-[[3-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2nc(C3CCCCC3)cc2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H25F3N2O3/c1-32-24(31)20-9-7-17(8-10-20)16-30-23(15-22(29-30)18-5-3-2-4-6-18)19-11-13-21(14-12-19)33-25(26,27)28/h7-15,18H,2-6,16H2,1H3 |
| InChIKey | ZWMRAXNXOFWSRE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |