C23H20F3N3OS2 — CID 143309584
1-[[4-(methylsulfanylamino)phenyl]methyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazole-2-thione (PubChem CID 143309584) has the molecular formula C23H20F3N3OS2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 1-[[4-(methylsulfanylamino)phenyl]methyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazole-2-thione.
| Compound Name | 1-[[4-(methylsulfanylamino)phenyl]methyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazole-2-thione |
|---|---|
| PubChem CID | 143309584 |
| Molecular Formula | C23H20F3N3OS2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-[[4-(methylsulfanylamino)phenyl]methyl]-3-[[4-(trifluoromethoxy)phenyl]methyl]benzimidazole-2-thione |
| SMILES | CSNc1ccc(Cn2c(=S)n(Cc3ccc(OC(F)(F)F)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H20F3N3OS2/c1-32-27-18-10-6-16(7-11-18)14-28-20-4-2-3-5-21(20)29(22(28)31)15-17-8-12-19(13-9-17)30-23(24,25)26/h2-13,27H,14-15H2,1H3 |
| InChIKey | NSABOKQWAKYKLY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 31.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|