C19H16F3N3O3 — CID 3656678
1-benzyl-3-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidine-2,4-dione (PubChem CID 3656678) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-benzyl-3-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-3-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3656678 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-benzyl-3-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(Nc2ccc(OC(F)(F)F)cc2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H16F3N3O3/c1-24-17(26)11-16(25(18(24)27)12-13-5-3-2-4-6-13)23-14-7-9-15(10-8-14)28-19(20,21)22/h2-11,23H,12H2,1H3 |
| InChIKey | WRTZYBISOBMPEW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |