C24H16F3N3O2 — CID 3971832
5-benzyl-2-[4-(trifluoromethoxy)phenyl]pyridazino[4,3-b]indol-3-one (PubChem CID 3971832) has the molecular formula C24H16F3N3O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is 5-benzyl-2-[4-(trifluoromethoxy)phenyl]pyridazino[4,3-b]indol-3-one.
| Compound Name | 5-benzyl-2-[4-(trifluoromethoxy)phenyl]pyridazino[4,3-b]indol-3-one |
|---|---|
| PubChem CID | 3971832 |
| Molecular Formula | C24H16F3N3O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 5-benzyl-2-[4-(trifluoromethoxy)phenyl]pyridazino[4,3-b]indol-3-one |
| SMILES | O=c1cc2c(nn1-c1ccc(OC(F)(F)F)cc1)c1ccccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C24H16F3N3O2/c25-24(26,27)32-18-12-10-17(11-13-18)30-22(31)14-21-23(28-30)19-8-4-5-9-20(19)29(21)15-16-6-2-1-3-7-16/h1-14H,15H2 |
| InChIKey | XBNIWJFFYRDNQF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |