C19H14F3N3O2S — CID 170621173
4-[[8-(trifluoromethoxy)pyrido[3,2-b]indol-5-yl]methyl]benzenesulfinamide (PubChem CID 170621173) has the molecular formula C19H14F3N3O2S and a molecular weight of 405.40 g/mol. Its IUPAC name is 4-[[8-(trifluoromethoxy)pyrido[3,2-b]indol-5-yl]methyl]benzenesulfinamide.
| Compound Name | 4-[[8-(trifluoromethoxy)pyrido[3,2-b]indol-5-yl]methyl]benzenesulfinamide |
|---|---|
| PubChem CID | 170621173 |
| Molecular Formula | C19H14F3N3O2S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-[[8-(trifluoromethoxy)pyrido[3,2-b]indol-5-yl]methyl]benzenesulfinamide |
| SMILES | NS(=O)c1ccc(Cn2c3ccc(OC(F)(F)F)cc3c3ncccc32)cc1 |
| InChI | InChI=1S/C19H14F3N3O2S/c20-19(21,22)27-13-5-8-16-15(10-13)18-17(2-1-9-24-18)25(16)11-12-3-6-14(7-4-12)28(23)26/h1-10H,11,23H2 |
| InChIKey | ZQZUQWLXFNNTKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |