C23H22FN2O4P — CID 170621200
[1-fluoro-1-[4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]but-3-enyl]phosphonic acid (PubChem CID 170621200) has the molecular formula C23H22FN2O4P and a molecular weight of 440.41 g/mol. Its IUPAC name is [1-fluoro-1-[4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]but-3-enyl]phosphonic acid.
| Compound Name | [1-fluoro-1-[4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]but-3-enyl]phosphonic acid |
|---|---|
| PubChem CID | 170621200 |
| Molecular Formula | C23H22FN2O4P |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [1-fluoro-1-[4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]but-3-enyl]phosphonic acid |
| SMILES | C=CCC(F)(c1ccc(Cn2c3ccc(OC)cc3c3ncccc32)cc1)P(=O)(O)O |
| InChI | InChI=1S/C23H22FN2O4P/c1-3-12-23(24,31(27,28)29)17-8-6-16(7-9-17)15-26-20-11-10-18(30-2)14-19(20)22-21(26)5-4-13-25-22/h3-11,13-14H,1,12,15H2,2H3,(H2,27,28,29) |
| InChIKey | WAOMBUFVKUKYDZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|