C18H15F3N2O3 — CID 72793279
6-methoxy-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)quinazolin-2-one (PubChem CID 72793279) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 6-methoxy-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)quinazolin-2-one.
| Compound Name | 6-methoxy-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)quinazolin-2-one |
|---|---|
| PubChem CID | 72793279 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 6-methoxy-1-[(4-methoxyphenyl)methyl]-4-(trifluoromethyl)quinazolin-2-one |
| SMILES | COc1ccc(Cn2c(=O)nc(C(F)(F)F)c3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C18H15F3N2O3/c1-25-12-5-3-11(4-6-12)10-23-15-8-7-13(26-2)9-14(15)16(18(19,20)21)22-17(23)24/h3-9H,10H2,1-2H3 |
| InChIKey | RXGONGKHRWFYKJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |