About [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid
[4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid (PubChem CID 170621255) has the molecular formula C25H21N2O4P
and a molecular weight of 444.43 g/mol. Its IUPAC name is [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid.
Molecular Properties
| Compound Name | [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid |
| PubChem CID | 170621255 |
| Molecular Formula | C25H21N2O4P |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid |
| SMILES | COc1ccc2c(c1)c1ncccc1n2Cc1ccc(P(=O)(O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N2O4P/c1-30-20-11-14-23-22(16-20)25-24(8-5-15-26-25)27(23)17-18-9-12-21(13-10-18)32(28,29)31-19-6-3-2-4-7-19/h2-16H,17H2,1H3,(H,28,29) |
| InChIKey | CLRXSRXTHQNSES-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid?
The IUPAC name of [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid (CID 170621255) is [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid.
What is the SMILES notation for [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid?
The canonical SMILES for [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid is COc1ccc2c(c1)c1ncccc1n2Cc1ccc(P(=O)(O)Oc2ccccc2)cc1.
What is the InChIKey of [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid?
The InChIKey is CLRXSRXTHQNSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N2O4P/c1-30-20-11-14-23-22(16-20)25-24(8-5-15-26-25)27(23)17-18-9-12-21(13-10-18)32(28,29)31-19-6-3-2-4-7-19/h2-16H,17H2,1H3,(H,28,29).
What are the key properties of [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid?
[4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid has a molecular weight of 444.43 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(8-methoxypyrido[3,2-b]indol-5-yl)methyl]phenyl]-phenoxyphosphinic acid is sourced from PubChem (CID 170621255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).