C21H14F4N2O2 — CID 174414934
6-fluoro-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazole-4-carboxamide (PubChem CID 174414934) has the molecular formula C21H14F4N2O2 and a molecular weight of 402.35 g/mol. Its IUPAC name is 6-fluoro-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazole-4-carboxamide.
| Compound Name | 6-fluoro-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174414934 |
| Molecular Formula | C21H14F4N2O2 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 6-fluoro-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cc(F)ccc1n2Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F4N2O2/c22-13-7-8-17-16(10-13)19-15(20(26)28)5-2-6-18(19)27(17)11-12-3-1-4-14(9-12)29-21(23,24)25/h1-10H,11H2,(H2,26,28) |
| InChIKey | UZNRDEZYXJGPCZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |