C20H12F4N2O — CID 174417840
6-fluoro-9-[(2,3,6-trifluorophenyl)methyl]carbazole-4-carboxamide (PubChem CID 174417840) has the molecular formula C20H12F4N2O and a molecular weight of 372.32 g/mol. Its IUPAC name is 6-fluoro-9-[(2,3,6-trifluorophenyl)methyl]carbazole-4-carboxamide.
| Compound Name | 6-fluoro-9-[(2,3,6-trifluorophenyl)methyl]carbazole-4-carboxamide |
|---|---|
| PubChem CID | 174417840 |
| Molecular Formula | C20H12F4N2O |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 6-fluoro-9-[(2,3,6-trifluorophenyl)methyl]carbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cc(F)ccc1n2Cc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C20H12F4N2O/c21-10-4-7-16-12(8-10)18-11(20(25)27)2-1-3-17(18)26(16)9-13-14(22)5-6-15(23)19(13)24/h1-8H,9H2,(H2,25,27) |
| InChIKey | FORUSDIGCSNPTJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|