C23H16F3NO5 — CID 175780981
2-[5-formyl-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazol-4-yl]oxyacetic acid (PubChem CID 175780981) has the molecular formula C23H16F3NO5 and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-[5-formyl-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazol-4-yl]oxyacetic acid.
| Compound Name | 2-[5-formyl-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazol-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 175780981 |
| Molecular Formula | C23H16F3NO5 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[5-formyl-9-[[3-(trifluoromethoxy)phenyl]methyl]carbazol-4-yl]oxyacetic acid |
| SMILES | O=Cc1cccc2c1c1c(OCC(=O)O)cccc1n2Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H16F3NO5/c24-23(25,26)32-16-6-1-4-14(10-16)11-27-17-7-2-5-15(12-28)21(17)22-18(27)8-3-9-19(22)31-13-20(29)30/h1-10,12H,11,13H2,(H,29,30) |
| InChIKey | USTGGNDXKUCJKA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|