C16H15ClF3N3O — CID 168824971
methyl-[[1-[4-(trifluoromethoxy)phenyl]indazol-3-yl]methyl]azanium chloride (PubChem CID 168824971) has the molecular formula C16H15ClF3N3O and a molecular weight of 357.76 g/mol. Its IUPAC name is methyl-[[1-[4-(trifluoromethoxy)phenyl]indazol-3-yl]methyl]azanium chloride.
| Compound Name | methyl-[[1-[4-(trifluoromethoxy)phenyl]indazol-3-yl]methyl]azanium chloride |
|---|---|
| PubChem CID | 168824971 |
| Molecular Formula | C16H15ClF3N3O |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl-[[1-[4-(trifluoromethoxy)phenyl]indazol-3-yl]methyl]azanium chloride |
| SMILES | C[NH2+]Cc1nn(-c2ccc(OC(F)(F)F)cc2)c2ccccc12.[Cl-] |
| InChI | InChI=1S/C16H14F3N3O.ClH/c1-20-10-14-13-4-2-3-5-15(13)22(21-14)11-6-8-12(9-7-11)23-16(17,18)19;/h2-9,20H,10H2,1H3;1H |
| InChIKey | MKXNPKGCBMMDDG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 43.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |