C19H19NO3 — CID 117175773
3-(phenoxymethyl)-1-propan-2-ylindole-5-carboxylic acid (PubChem CID 117175773) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is 3-(phenoxymethyl)-1-propan-2-ylindole-5-carboxylic acid.
| Compound Name | 3-(phenoxymethyl)-1-propan-2-ylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 117175773 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-(phenoxymethyl)-1-propan-2-ylindole-5-carboxylic acid |
| SMILES | CC(C)n1cc(COc2ccccc2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C19H19NO3/c1-13(2)20-11-15(12-23-16-6-4-3-5-7-16)17-10-14(19(21)22)8-9-18(17)20/h3-11,13H,12H2,1-2H3,(H,21,22) |
| InChIKey | RWHZFGOMERQUEJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |