C13H15NO3 — CID 117175803
3-(hydroxymethyl)-1-propan-2-ylindole-5-carboxylic acid (PubChem CID 117175803) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-propan-2-ylindole-5-carboxylic acid.
| Compound Name | 3-(hydroxymethyl)-1-propan-2-ylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 117175803 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-(hydroxymethyl)-1-propan-2-ylindole-5-carboxylic acid |
| SMILES | CC(C)n1cc(CO)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C13H15NO3/c1-8(2)14-6-10(7-15)11-5-9(13(16)17)3-4-12(11)14/h3-6,8,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | BDLWSTPIPRCATJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |