C30H29N3O4 — CID 157387510
butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid (PubChem CID 157387510) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid.
| Compound Name | butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 157387510 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid |
| SMILES | CCCC(N)=O.O=C(O)c1ccc2c(c1)cc(COc1ccccc1)n2Cc1cccc2cccnc12 |
| InChI | InChI=1S/C26H20N2O3.C4H9NO/c29-26(30)19-11-12-24-21(14-19)15-22(17-31-23-9-2-1-3-10-23)28(24)16-20-7-4-6-18-8-5-13-27-25(18)20;1-2-3-4(5)6/h1-15H,16-17H2,(H,29,30);2-3H2,1H3,(H2,5,6) |
| InChIKey | BLPJQLJPTPFZGG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |