About butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid
butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid (PubChem CID 157387510) has the molecular formula C30H29N3O4
and a molecular weight of 495.58 g/mol. Its IUPAC name is butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid.
Molecular Properties
| Compound Name | butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid |
| PubChem CID | 157387510 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid |
| SMILES | CCCC(N)=O.O=C(O)c1ccc2c(c1)cc(COc1ccccc1)n2Cc1cccc2cccnc12 |
| InChI | InChI=1S/C26H20N2O3.C4H9NO/c29-26(30)19-11-12-24-21(14-19)15-22(17-31-23-9-2-1-3-10-23)28(24)16-20-7-4-6-18-8-5-13-27-25(18)20;1-2-3-4(5)6/h1-15H,16-17H2,(H,29,30);2-3H2,1H3,(H2,5,6) |
| InChIKey | BLPJQLJPTPFZGG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid?
The IUPAC name of butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid (CID 157387510) is butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid.
What is the SMILES notation for butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid?
The canonical SMILES for butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid is CCCC(N)=O.O=C(O)c1ccc2c(c1)cc(COc1ccccc1)n2Cc1cccc2cccnc12.
What is the InChIKey of butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid?
The InChIKey is BLPJQLJPTPFZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O3.C4H9NO/c29-26(30)19-11-12-24-21(14-19)15-22(17-31-23-9-2-1-3-10-23)28(24)16-20-7-4-6-18-8-5-13-27-25(18)20;1-2-3-4(5)6/h1-15H,16-17H2,(H,29,30);2-3H2,1H3,(H2,5,6).
What are the key properties of butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid?
butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid has a molecular weight of 495.58 g/mol, XLogP of 5.79, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;2-(phenoxymethyl)-1-(quinolin-8-ylmethyl)indole-5-carboxylic acid is sourced from PubChem (CID 157387510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).