C23H24ClNO3 — CID 22627324
methyl 1-[(2-chlorophenyl)methyl]-2-ethyl-3-(2-methylpropanoyl)indole-6-carboxylate (PubChem CID 22627324) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is methyl 1-[(2-chlorophenyl)methyl]-2-ethyl-3-(2-methylpropanoyl)indole-6-carboxylate.
| Compound Name | methyl 1-[(2-chlorophenyl)methyl]-2-ethyl-3-(2-methylpropanoyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 22627324 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 1-[(2-chlorophenyl)methyl]-2-ethyl-3-(2-methylpropanoyl)indole-6-carboxylate |
| SMILES | CCc1c(C(=O)C(C)C)c2ccc(C(=O)OC)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H24ClNO3/c1-5-19-21(22(26)14(2)3)17-11-10-15(23(27)28-4)12-20(17)25(19)13-16-8-6-7-9-18(16)24/h6-12,14H,5,13H2,1-4H3 |
| InChIKey | ZCPWRPCSBYZQLW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |