C24H24N2O3 — CID 22627202
1-[(2-cyanophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxylic acid (PubChem CID 22627202) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[(2-cyanophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxylic acid.
| Compound Name | 1-[(2-cyanophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 22627202 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[(2-cyanophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxylic acid |
| SMILES | CCCc1c(C(=O)C(C)C)c2ccc(C(=O)O)cc2n1Cc1ccccc1C#N |
| InChI | InChI=1S/C24H24N2O3/c1-4-7-20-22(23(27)15(2)3)19-11-10-16(24(28)29)12-21(19)26(20)14-18-9-6-5-8-17(18)13-25/h5-6,8-12,15H,4,7,14H2,1-3H3,(H,28,29) |
| InChIKey | DHKAUGMSEPXRDO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |