C22H23ClFNO — CID 54147653
1-[1-[(4-chloro-2-fluorophenyl)methyl]-2-propylindol-3-yl]-2-methylpropan-1-one (PubChem CID 54147653) has the molecular formula C22H23ClFNO and a molecular weight of 371.88 g/mol. Its IUPAC name is 1-[1-[(4-chloro-2-fluorophenyl)methyl]-2-propylindol-3-yl]-2-methylpropan-1-one.
| Compound Name | 1-[1-[(4-chloro-2-fluorophenyl)methyl]-2-propylindol-3-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 54147653 |
| Molecular Formula | C22H23ClFNO |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[1-[(4-chloro-2-fluorophenyl)methyl]-2-propylindol-3-yl]-2-methylpropan-1-one |
| SMILES | CCCc1c(C(=O)C(C)C)c2ccccc2n1Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H23ClFNO/c1-4-7-20-21(22(26)14(2)3)17-8-5-6-9-19(17)25(20)13-15-10-11-16(23)12-18(15)24/h5-6,8-12,14H,4,7,13H2,1-3H3 |
| InChIKey | OFNKVVFHNJUIRJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |