C32H40N6O2 — CID 156770625
6-[N'-(4-aminocyclohexyl)carbamimidoyl]-1-[[6-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]indole-2-carboxamide (PubChem CID 156770625) has the molecular formula C32H40N6O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 6-[N'-(4-aminocyclohexyl)carbamimidoyl]-1-[[6-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]indole-2-carboxamide.
| Compound Name | 6-[N'-(4-aminocyclohexyl)carbamimidoyl]-1-[[6-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 156770625 |
| Molecular Formula | C32H40N6O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 6-[N'-(4-aminocyclohexyl)carbamimidoyl]-1-[[6-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]indole-2-carboxamide |
| SMILES | CN(C)CCCOc1ccc2c(Cn3c(C(N)=O)cc4ccc(/C(N)=N/C5CCC(N)CC5)cc43)cccc2c1 |
| InChI | InChI=1S/C32H40N6O2/c1-37(2)15-4-16-40-27-13-14-28-21(17-27)5-3-6-24(28)20-38-29-19-23(8-7-22(29)18-30(38)32(35)39)31(34)36-26-11-9-25(33)10-12-26/h3,5-8,13-14,17-19,25-26H,4,9-12,15-16,20,33H2,1-2H3,(H2,34,36)(H2,35,39) |
| InChIKey | IDXMZGUKVWPSQF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|