C28H29N5O2 — CID 167341057
6-carbamimidoyl-N-(4-formamidocyclohexyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide (PubChem CID 167341057) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 6-carbamimidoyl-N-(4-formamidocyclohexyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide.
| Compound Name | 6-carbamimidoyl-N-(4-formamidocyclohexyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 167341057 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 6-carbamimidoyl-N-(4-formamidocyclohexyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)NC3CCC(NC=O)CC3)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C28H29N5O2/c29-27(30)20-9-8-19-14-26(28(35)32-23-12-10-22(11-13-23)31-17-34)33(25(19)15-20)16-21-6-3-5-18-4-1-2-7-24(18)21/h1-9,14-15,17,22-23H,10-13,16H2,(H3,29,30)(H,31,34)(H,32,35) |
| InChIKey | YAGSGMWSCKSAOD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|