C34H35N5O4S — CID 167340916
[4-[[2-[(4-aminocyclohexyl)carbamoyl]-6-carbamimidoylindol-1-yl]methyl]naphthalen-2-yl] 4-methylbenzenesulfonate (PubChem CID 167340916) has the molecular formula C34H35N5O4S and a molecular weight of 609.75 g/mol. Its IUPAC name is [4-[[2-[(4-aminocyclohexyl)carbamoyl]-6-carbamimidoylindol-1-yl]methyl]naphthalen-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[2-[(4-aminocyclohexyl)carbamoyl]-6-carbamimidoylindol-1-yl]methyl]naphthalen-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 167340916 |
| Molecular Formula | C34H35N5O4S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | [4-[[2-[(4-aminocyclohexyl)carbamoyl]-6-carbamimidoylindol-1-yl]methyl]naphthalen-2-yl] 4-methylbenzenesulfonate |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)NC3CCC(N)CC3)n(Cc3cc(OS(=O)(=O)c4ccc(C)cc4)cc4ccccc34)c2c1 |
| InChI | InChI=1S/C34H35N5O4S/c1-21-6-14-29(15-7-21)44(41,42)43-28-16-22-4-2-3-5-30(22)25(17-28)20-39-31-19-24(33(36)37)9-8-23(31)18-32(39)34(40)38-27-12-10-26(35)11-13-27/h2-9,14-19,26-27H,10-13,20,35H2,1H3,(H3,36,37)(H,38,40) |
| InChIKey | OEFOXDFRTOWAAL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|