C22H17NO4 — CID 58900234
3-(carboxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid (PubChem CID 58900234) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-(carboxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 58900234 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-(carboxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid |
| SMILES | O=C(O)Cc1c(C(=O)O)n(Cc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C22H17NO4/c24-20(25)12-18-17-10-3-4-11-19(17)23(21(18)22(26)27)13-15-8-5-7-14-6-1-2-9-16(14)15/h1-11H,12-13H2,(H,24,25)(H,26,27) |
| InChIKey | ZMKWPJJBVHUQBL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|