C22H16FNO4 — CID 58900279
3-(carboxymethyl)-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylic acid (PubChem CID 58900279) has the molecular formula C22H16FNO4 and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-(carboxymethyl)-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 58900279 |
| Molecular Formula | C22H16FNO4 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-(carboxymethyl)-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)Cc1c(C(=O)O)n(Cc2cccc3ccc(F)cc23)c2ccccc12 |
| InChI | InChI=1S/C22H16FNO4/c23-15-9-8-13-4-3-5-14(17(13)10-15)12-24-19-7-2-1-6-16(19)18(11-20(25)26)21(24)22(27)28/h1-10H,11-12H2,(H,25,26)(H,27,28) |
| InChIKey | CURAGSODTZBWJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|