C26H23F2NO4 — CID 68578655
ethyl 3-(2-ethoxy-2-oxoethyl)-5-fluoro-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylate (PubChem CID 68578655) has the molecular formula C26H23F2NO4 and a molecular weight of 451.47 g/mol. Its IUPAC name is ethyl 3-(2-ethoxy-2-oxoethyl)-5-fluoro-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylate.
| Compound Name | ethyl 3-(2-ethoxy-2-oxoethyl)-5-fluoro-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 68578655 |
| Molecular Formula | C26H23F2NO4 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | ethyl 3-(2-ethoxy-2-oxoethyl)-5-fluoro-1-[(7-fluoronaphthalen-1-yl)methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)n(Cc2cccc3ccc(F)cc23)c2ccc(F)cc12 |
| InChI | InChI=1S/C26H23F2NO4/c1-3-32-24(30)14-22-21-13-19(28)10-11-23(21)29(25(22)26(31)33-4-2)15-17-7-5-6-16-8-9-18(27)12-20(16)17/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | PKMRTGIJJHBDRW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|