C22H20F2N2O4S2 — CID 68577919
ethyl 5-fluoro-1-[(5-fluoro-1-benzothiophen-3-yl)methyl]-3-(methanesulfonamidomethyl)indole-2-carboxylate (PubChem CID 68577919) has the molecular formula C22H20F2N2O4S2 and a molecular weight of 478.54 g/mol. Its IUPAC name is ethyl 5-fluoro-1-[(5-fluoro-1-benzothiophen-3-yl)methyl]-3-(methanesulfonamidomethyl)indole-2-carboxylate.
| Compound Name | ethyl 5-fluoro-1-[(5-fluoro-1-benzothiophen-3-yl)methyl]-3-(methanesulfonamidomethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 68577919 |
| Molecular Formula | C22H20F2N2O4S2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | ethyl 5-fluoro-1-[(5-fluoro-1-benzothiophen-3-yl)methyl]-3-(methanesulfonamidomethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CNS(C)(=O)=O)c2cc(F)ccc2n1Cc1csc2ccc(F)cc12 |
| InChI | InChI=1S/C22H20F2N2O4S2/c1-3-30-22(27)21-18(10-25-32(2,28)29)17-9-14(23)4-6-19(17)26(21)11-13-12-31-20-7-5-15(24)8-16(13)20/h4-9,12,25H,3,10-11H2,1-2H3 |
| InChIKey | OLOBTASKAANXMJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|