C22H20N2O2S — CID 45106358
1-benzyl-3-[(thiophen-2-ylmethylamino)methyl]indole-2-carboxylic acid (PubChem CID 45106358) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-benzyl-3-[(thiophen-2-ylmethylamino)methyl]indole-2-carboxylic acid.
| Compound Name | 1-benzyl-3-[(thiophen-2-ylmethylamino)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 45106358 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-benzyl-3-[(thiophen-2-ylmethylamino)methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(CNCc2cccs2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C22H20N2O2S/c25-22(26)21-19(14-23-13-17-9-6-12-27-17)18-10-4-5-11-20(18)24(21)15-16-7-2-1-3-8-16/h1-12,23H,13-15H2,(H,25,26) |
| InChIKey | GFUJPRGZEMFUQI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|