C22H21F4NO4S — CID 66936503
ethyl 2-[5-fluoro-2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate (PubChem CID 66936503) has the molecular formula C22H21F4NO4S and a molecular weight of 471.47 g/mol. Its IUPAC name is ethyl 2-[5-fluoro-2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate.
| Compound Name | ethyl 2-[5-fluoro-2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 66936503 |
| Molecular Formula | C22H21F4NO4S |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | ethyl 2-[5-fluoro-2-methyl-1-[[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)n(Cc2ccc(S(C)(=O)=O)cc2C(F)(F)F)c2ccc(F)cc12 |
| InChI | InChI=1S/C22H21F4NO4S/c1-4-31-21(28)11-17-13(2)27(20-8-6-15(23)9-18(17)20)12-14-5-7-16(32(3,29)30)10-19(14)22(24,25)26/h5-10H,4,11-12H2,1-3H3 |
| InChIKey | ZBJPSUREQMAFDS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|