C22H19FO5S — CID 59350811
ethyl 2-[6-fluoro-4-(4-methylsulfonylbenzoyl)naphthalen-2-yl]acetate (PubChem CID 59350811) has the molecular formula C22H19FO5S and a molecular weight of 414.45 g/mol. Its IUPAC name is ethyl 2-[6-fluoro-4-(4-methylsulfonylbenzoyl)naphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[6-fluoro-4-(4-methylsulfonylbenzoyl)naphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 59350811 |
| Molecular Formula | C22H19FO5S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | ethyl 2-[6-fluoro-4-(4-methylsulfonylbenzoyl)naphthalen-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(=O)c2ccc(S(C)(=O)=O)cc2)c2cc(F)ccc2c1 |
| InChI | InChI=1S/C22H19FO5S/c1-3-28-21(24)12-14-10-16-4-7-17(23)13-19(16)20(11-14)22(25)15-5-8-18(9-6-15)29(2,26)27/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | LEOZEISMTCOOAS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |