C21H15F3O5S — CID 46202635
2-[4-(4-methylsulfonylbenzoyl)-6-(trifluoromethyl)naphthalen-2-yl]acetic acid (PubChem CID 46202635) has the molecular formula C21H15F3O5S and a molecular weight of 436.41 g/mol. Its IUPAC name is 2-[4-(4-methylsulfonylbenzoyl)-6-(trifluoromethyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[4-(4-methylsulfonylbenzoyl)-6-(trifluoromethyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 46202635 |
| Molecular Formula | C21H15F3O5S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-[4-(4-methylsulfonylbenzoyl)-6-(trifluoromethyl)naphthalen-2-yl]acetic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)c2cc(CC(=O)O)cc3ccc(C(F)(F)F)cc23)cc1 |
| InChI | InChI=1S/C21H15F3O5S/c1-30(28,29)16-6-3-13(4-7-16)20(27)18-9-12(10-19(25)26)8-14-2-5-15(11-17(14)18)21(22,23)24/h2-9,11H,10H2,1H3,(H,25,26) |
| InChIKey | RKTXEUUTPKVYMH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |