C12H10F3NO2 — CID 22490524
2-[2-methyl-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid (PubChem CID 22490524) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 2-[2-methyl-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-methyl-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 22490524 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[2-methyl-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
| SMILES | Cc1[nH]c2ccc(C(F)(F)F)cc2c1CC(=O)O |
| InChI | InChI=1S/C12H10F3NO2/c1-6-8(5-11(17)18)9-4-7(12(13,14)15)2-3-10(9)16-6/h2-4,16H,5H2,1H3,(H,17,18) |
| InChIKey | SIIBWPIHYPORDK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|