C18H13F3N2O3 — CID 18542320
2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid (PubChem CID 18542320) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is 2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18542320 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethyl)-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccnc(C(=O)c2[nH]c3ccc(C(F)(F)F)cc3c2CC(=O)O)c1 |
| InChI | InChI=1S/C18H13F3N2O3/c1-9-4-5-22-14(6-9)17(26)16-12(8-15(24)25)11-7-10(18(19,20)21)2-3-13(11)23-16/h2-7,23H,8H2,1H3,(H,24,25) |
| InChIKey | UVHKKXATRFCHKH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|