C11H8FNO4 — CID 18780519
3-(carboxymethyl)-5-fluoro-1H-indole-2-carboxylic acid (PubChem CID 18780519) has the molecular formula C11H8FNO4 and a molecular weight of 237.19 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-fluoro-1H-indole-2-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-5-fluoro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 18780519 |
| Molecular Formula | C11H8FNO4 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3-(carboxymethyl)-5-fluoro-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)Cc1c(C(=O)O)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C11H8FNO4/c12-5-1-2-8-6(3-5)7(4-9(14)15)10(13-8)11(16)17/h1-3,13H,4H2,(H,14,15)(H,16,17) |
| InChIKey | XICVSOJBZNERDS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|