C12H13FN2O2 — CID 91076811
5-fluoro-3-(3-hydroxypropyl)-1H-indole-2-carboxamide (PubChem CID 91076811) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 5-fluoro-3-(3-hydroxypropyl)-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-3-(3-hydroxypropyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91076811 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 5-fluoro-3-(3-hydroxypropyl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(F)cc2c1CCCO |
| InChI | InChI=1S/C12H13FN2O2/c13-7-3-4-10-9(6-7)8(2-1-5-16)11(15-10)12(14)17/h3-4,6,15-16H,1-2,5H2,(H2,14,17) |
| InChIKey | ZWERKSNCQQNOSS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|