C12H13FN2O2 — CID 170891713
3-(2-aminopropyl)-5-fluoro-1H-indole-2-carboxylic acid (PubChem CID 170891713) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-(2-aminopropyl)-5-fluoro-1H-indole-2-carboxylic acid.
| Compound Name | 3-(2-aminopropyl)-5-fluoro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170891713 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(2-aminopropyl)-5-fluoro-1H-indole-2-carboxylic acid |
| SMILES | CC(N)Cc1c(C(=O)O)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C12H13FN2O2/c1-6(14)4-9-8-5-7(13)2-3-10(8)15-11(9)12(16)17/h2-3,5-6,15H,4,14H2,1H3,(H,16,17) |
| InChIKey | VDXLCVXZINWNFY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|