C15H15FN2O3 — CID 82214084
3-[(cyclobutanecarbonylamino)methyl]-5-fluoro-1H-indole-2-carboxylic acid (PubChem CID 82214084) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 3-[(cyclobutanecarbonylamino)methyl]-5-fluoro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(cyclobutanecarbonylamino)methyl]-5-fluoro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 82214084 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-[(cyclobutanecarbonylamino)methyl]-5-fluoro-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2ccc(F)cc2c1CNC(=O)C1CCC1 |
| InChI | InChI=1S/C15H15FN2O3/c16-9-4-5-12-10(6-9)11(13(18-12)15(20)21)7-17-14(19)8-2-1-3-8/h4-6,8,18H,1-3,7H2,(H,17,19)(H,20,21) |
| InChIKey | LZVRPPVSGHWXKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|