C17H21N3O3 — CID 94949079
3-[(cyclobutanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid (PubChem CID 94949079) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[(cyclobutanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(cyclobutanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 94949079 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[(cyclobutanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid |
| SMILES | CN(C)c1ccc2[nH]c(C(=O)O)c(CNC(=O)C3CCC3)c2c1 |
| InChI | InChI=1S/C17H21N3O3/c1-20(2)11-6-7-14-12(8-11)13(15(19-14)17(22)23)9-18-16(21)10-4-3-5-10/h6-8,10,19H,3-5,9H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | JVFRXRULLARQGT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|