C16H19N3O3 — CID 82214157
3-[(cyclopropanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid (PubChem CID 82214157) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[(cyclopropanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(cyclopropanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 82214157 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-[(cyclopropanecarbonylamino)methyl]-5-(dimethylamino)-1H-indole-2-carboxylic acid |
| SMILES | CN(C)c1ccc2[nH]c(C(=O)O)c(CNC(=O)C3CC3)c2c1 |
| InChI | InChI=1S/C16H19N3O3/c1-19(2)10-5-6-13-11(7-10)12(14(18-13)16(21)22)8-17-15(20)9-3-4-9/h5-7,9,18H,3-4,8H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | GWKHYAYLBBMXOX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|