C13H11F3N2O3 — CID 82214142
5-methyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]-1H-indole-2-carboxylic acid (PubChem CID 82214142) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 5-methyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-methyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 82214142 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-methyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc2[nH]c(C(=O)O)c(CNC(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H11F3N2O3/c1-6-2-3-9-7(4-6)8(10(18-9)11(19)20)5-17-12(21)13(14,15)16/h2-4,18H,5H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | RJBCZJOWTZSNCT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|