C15H17ClN2O3 — CID 94949083
5-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-1H-indole-2-carboxylic acid (PubChem CID 94949083) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is 5-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 94949083 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-chloro-3-[(2,2-dimethylpropanoylamino)methyl]-1H-indole-2-carboxylic acid |
| SMILES | CC(C)(C)C(=O)NCc1c(C(=O)O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H17ClN2O3/c1-15(2,3)14(21)17-7-10-9-6-8(16)4-5-11(9)18-12(10)13(19)20/h4-6,18H,7H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | KURWAPPXXSYQNO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|