C18H14Cl2N2O4 — CID 25016841
5-chloro-3-[2-(4-chloro-3-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid (PubChem CID 25016841) has the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.23 g/mol. Its IUPAC name is 5-chloro-3-[2-(4-chloro-3-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-(4-chloro-3-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25016841 |
| Molecular Formula | C18H14Cl2N2O4 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 5-chloro-3-[2-(4-chloro-3-methoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| SMILES | COc1cc(NC(=O)Cc2c(C(=O)O)[nH]c3ccc(Cl)cc23)ccc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O4/c1-26-15-7-10(3-4-13(15)20)21-16(23)8-12-11-6-9(19)2-5-14(11)22-17(12)18(24)25/h2-7,22H,8H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | LGCAAQORTQOEGU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|