C17H11ClF2N2O3 — CID 22431016
5-chloro-3-[2-(2,4-difluoroanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid (PubChem CID 22431016) has the molecular formula C17H11ClF2N2O3 and a molecular weight of 364.74 g/mol. Its IUPAC name is 5-chloro-3-[2-(2,4-difluoroanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-(2,4-difluoroanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22431016 |
| Molecular Formula | C17H11ClF2N2O3 |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 5-chloro-3-[2-(2,4-difluoroanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(Cc1c(C(=O)O)[nH]c2ccc(Cl)cc12)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H11ClF2N2O3/c18-8-1-3-13-10(5-8)11(16(22-13)17(24)25)7-15(23)21-14-4-2-9(19)6-12(14)20/h1-6,22H,7H2,(H,21,23)(H,24,25) |
| InChIKey | TXYVPDHGSGFPDT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|