C18H16Cl2N2O3 — CID 113204787
5-chloro-N-(4-chloro-2,5-dimethoxyphenyl)-3-methyl-1H-indole-2-carboxamide (PubChem CID 113204787) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 5-chloro-N-(4-chloro-2,5-dimethoxyphenyl)-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-(4-chloro-2,5-dimethoxyphenyl)-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113204787 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 5-chloro-N-(4-chloro-2,5-dimethoxyphenyl)-3-methyl-1H-indole-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2[nH]c3ccc(Cl)cc3c2C)c(OC)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-9-11-6-10(19)4-5-13(11)21-17(9)18(23)22-14-8-15(24-2)12(20)7-16(14)25-3/h4-8,21H,1-3H3,(H,22,23) |
| InChIKey | SSLLKUSCYHZVCB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|