C18H17ClN2O2 — CID 113205343
6-chloro-N-(2-methoxy-5-methylphenyl)-3-methyl-1H-indole-2-carboxamide (PubChem CID 113205343) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 6-chloro-N-(2-methoxy-5-methylphenyl)-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-(2-methoxy-5-methylphenyl)-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113205343 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 6-chloro-N-(2-methoxy-5-methylphenyl)-3-methyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1[nH]c2cc(Cl)ccc2c1C |
| InChI | InChI=1S/C18H17ClN2O2/c1-10-4-7-16(23-3)15(8-10)21-18(22)17-11(2)13-6-5-12(19)9-14(13)20-17/h4-9,20H,1-3H3,(H,21,22) |
| InChIKey | ZYSJMKONSMNUED-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|