C15H14ClN3O2 — CID 155913457
5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)-3-methyl-1H-indole-2-carboxamide (PubChem CID 155913457) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155913457 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1noc(NC(=O)c2[nH]c3ccc(Cl)cc3c2C)c1C |
| InChI | InChI=1S/C15H14ClN3O2/c1-7-9(3)19-21-15(7)18-14(20)13-8(2)11-6-10(16)4-5-12(11)17-13/h4-6,17H,1-3H3,(H,18,20) |
| InChIKey | MLSIWCZKABHBFH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|