About 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide
2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide (PubChem CID 103722577) has the molecular formula C12H10BrClN2O2
and a molecular weight of 329.58 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide |
| PubChem CID | 103722577 |
| Molecular Formula | C12H10BrClN2O2 |
| Molecular Weight | 329.58 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide |
| SMILES | Cc1noc(NC(=O)c2cc(Cl)ccc2Br)c1C |
| InChI | InChI=1S/C12H10BrClN2O2/c1-6-7(2)16-18-12(6)15-11(17)9-5-8(14)3-4-10(9)13/h3-5H,1-2H3,(H,15,17) |
| InChIKey | CYAFMRWFUHWVQB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide?
The IUPAC name of 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide (CID 103722577) is 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide?
The canonical SMILES for 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide is Cc1noc(NC(=O)c2cc(Cl)ccc2Br)c1C.
What is the InChIKey of 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide?
The InChIKey is CYAFMRWFUHWVQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrClN2O2/c1-6-7(2)16-18-12(6)15-11(17)9-5-8(14)3-4-10(9)13/h3-5H,1-2H3,(H,15,17).
What are the key properties of 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide?
2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide has a molecular weight of 329.58 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-chloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 103722577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).